About ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane
ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane (PubChem CID 144547756) has the molecular formula C12H31BN2O4
and a molecular weight of 278.20 g/mol. Its IUPAC name is ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane.
Molecular Properties
| Compound Name | ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane |
| PubChem CID | 144547756 |
| Molecular Formula | C12H31BN2O4 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane |
| SMILES | CC.CC(C)C.CNC(C(=O)NCB(O)O)C(C)O |
| InChI | InChI=1S/C6H15BN2O4.C4H10.C2H6/c1-4(10)5(8-2)6(11)9-3-7(12)13;1-4(2)3;1-2/h4-5,8,10,12-13H,3H2,1-2H3,(H,9,11);4H,1-3H3;1-2H3 |
| InChIKey | CFBLRLDAXLRNDO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane?
The IUPAC name of ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane (CID 144547756) is ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane.
What is the SMILES notation for ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane?
The canonical SMILES for ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane is CC.CC(C)C.CNC(C(=O)NCB(O)O)C(C)O.
What is the InChIKey of ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane?
The InChIKey is CFBLRLDAXLRNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BN2O4.C4H10.C2H6/c1-4(10)5(8-2)6(11)9-3-7(12)13;1-4(2)3;1-2/h4-5,8,10,12-13H,3H2,1-2H3,(H,9,11);4H,1-3H3;1-2H3.
What are the key properties of ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane?
ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane has a molecular weight of 278.20 g/mol, XLogP of -0.23, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane is sourced from PubChem (CID 144547756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).