C12H31BN2O4 — CID 144547756
ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane (PubChem CID 144547756) has the molecular formula C12H31BN2O4 and a molecular weight of 278.20 g/mol. Its IUPAC name is ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane.
| Compound Name | ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane |
|---|---|
| PubChem CID | 144547756 |
| Molecular Formula | C12H31BN2O4 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | ethane;[[3-hydroxy-2-(methylamino)butanoyl]amino]methylboronic acid;2-methylpropane |
| SMILES | CC.CC(C)C.CNC(C(=O)NCB(O)O)C(C)O |
| InChI | InChI=1S/C6H15BN2O4.C4H10.C2H6/c1-4(10)5(8-2)6(11)9-3-7(12)13;1-4(2)3;1-2/h4-5,8,10,12-13H,3H2,1-2H3,(H,9,11);4H,1-3H3;1-2H3 |
| InChIKey | CFBLRLDAXLRNDO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|