C9H17N3O4 — CID 118940542
(2S,3R)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-3-hydroxy-2-(methylamino)butanamide (PubChem CID 118940542) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2S,3R)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-3-hydroxy-2-(methylamino)butanamide.
| Compound Name | (2S,3R)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-3-hydroxy-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 118940542 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (2S,3R)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-3-hydroxy-2-(methylamino)butanamide |
| SMILES | CN[C@H](C(=O)N[C@H](C=O)CC(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C9H17N3O4/c1-5(14)8(11-2)9(16)12-6(4-13)3-7(10)15/h4-6,8,11,14H,3H2,1-2H3,(H2,10,15)(H,12,16)/t5-,6+,8+/m1/s1 |
| InChIKey | STFUYHVEKRUQQE-CHKWXVPMSA-N |
| XLogP | -2.49 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|