C11H22N4O3 — CID 88560035
(2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-(aminomethylamino)-4-methylpentanamide (PubChem CID 88560035) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-(aminomethylamino)-4-methylpentanamide.
| Compound Name | (2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-(aminomethylamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 88560035 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2S)-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-(aminomethylamino)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NCN)C(=O)N[C@H](C=O)CC(N)=O |
| InChI | InChI=1S/C11H22N4O3/c1-7(2)3-9(14-6-12)11(18)15-8(5-16)4-10(13)17/h5,7-9,14H,3-4,6,12H2,1-2H3,(H2,13,17)(H,15,18)/t8-,9-/m0/s1 |
| InChIKey | IPPDZZVVWAWIOS-IUCAKERBSA-N |
| XLogP | -1.53 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|