C17H31N5O5 — CID 164513488
(2S)-6-acetamido-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanamide (PubChem CID 164513488) has the molecular formula C17H31N5O5 and a molecular weight of 385.47 g/mol. Its IUPAC name is (2S)-6-acetamido-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanamide.
| Compound Name | (2S)-6-acetamido-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 164513488 |
| Molecular Formula | C17H31N5O5 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2S)-6-acetamido-N-[(2S)-4-amino-1,4-dioxobutan-2-yl]-2-[[(2S)-2-amino-3-methylbutanoyl]amino]hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H](C=O)CC(N)=O |
| InChI | InChI=1S/C17H31N5O5/c1-10(2)15(19)17(27)22-13(6-4-5-7-20-11(3)24)16(26)21-12(9-23)8-14(18)25/h9-10,12-13,15H,4-8,19H2,1-3H3,(H2,18,25)(H,20,24)(H,21,26)(H,22,27)/t12-,13-,15-/m0/s1 |
| InChIKey | CCVWFNHLVUVREW-YDHLFZDLSA-N |
| XLogP | -1.68 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|