C22H56N2O2 — CID 160748270
ethane;(3S)-3-(methylamino)-4-oxobutanamide;methylcyclobutane (PubChem CID 160748270) has the molecular formula C22H56N2O2 and a molecular weight of 380.70 g/mol. Its IUPAC name is ethane;(3S)-3-(methylamino)-4-oxobutanamide;methylcyclobutane.
| Compound Name | ethane;(3S)-3-(methylamino)-4-oxobutanamide;methylcyclobutane |
|---|---|
| PubChem CID | 160748270 |
| Molecular Formula | C22H56N2O2 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 380.43 |
| IUPAC Name | ethane;(3S)-3-(methylamino)-4-oxobutanamide;methylcyclobutane |
| SMILES | CC.CC.CC.CC.CC.CC.CC1CCC1.CN[C@H](C=O)CC(N)=O |
| InChI | InChI=1S/C5H10N2O2.C5H10.6C2H6/c1-7-4(3-8)2-5(6)9;1-5-3-2-4-5;6*1-2/h3-4,7H,2H2,1H3,(H2,6,9);5H,2-4H2,1H3;6*1-2H3/t4-;;;;;;;/m0......./s1 |
| InChIKey | RWLZUVNFHSABOH-SHLRAKAPSA-N |
| XLogP | 6.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|