C9H18N2O4 — CID 58350605
(2S,5S,6R)-1,6-dihydroxy-2,5-bis(methylamino)heptane-3,4-dione (PubChem CID 58350605) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2S,5S,6R)-1,6-dihydroxy-2,5-bis(methylamino)heptane-3,4-dione.
| Compound Name | (2S,5S,6R)-1,6-dihydroxy-2,5-bis(methylamino)heptane-3,4-dione |
|---|---|
| PubChem CID | 58350605 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S,5S,6R)-1,6-dihydroxy-2,5-bis(methylamino)heptane-3,4-dione |
| SMILES | CN[C@@H](CO)C(=O)C(=O)[C@@H](NC)[C@@H](C)O |
| InChI | InChI=1S/C9H18N2O4/c1-5(13)7(11-3)9(15)8(14)6(4-12)10-2/h5-7,10-13H,4H2,1-3H3/t5-,6+,7+/m1/s1 |
| InChIKey | WONANEJIQIVWBB-VQVTYTSYSA-N |
| XLogP | -2.33 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|