C30H44BClN6O8 — CID 144791236
[[6-amino-2-[[2-[[2-[[2-[[4-(4-chlorophenyl)benzoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoyl]amino]methylboronic acid;ethane (PubChem CID 144791236) has the molecular formula C30H44BClN6O8 and a molecular weight of 662.98 g/mol. Its IUPAC name is [[6-amino-2-[[2-[[2-[[2-[[4-(4-chlorophenyl)benzoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoyl]amino]methylboronic acid;ethane.
| Compound Name | [[6-amino-2-[[2-[[2-[[2-[[4-(4-chlorophenyl)benzoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoyl]amino]methylboronic acid;ethane |
|---|---|
| PubChem CID | 144791236 |
| Molecular Formula | C30H44BClN6O8 |
| Molecular Weight | 662.98 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | [[6-amino-2-[[2-[[2-[[2-[[4-(4-chlorophenyl)benzoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]hexanoyl]amino]methylboronic acid;ethane |
| SMILES | CC.CC(O)C(NC(=O)CNC(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)NCC(=O)NC(CCCCN)C(=O)NCB(O)O |
| InChI | InChI=1S/C28H38BClN6O8.C2H6/c1-17(37)25(28(42)33-14-23(38)35-22(4-2-3-13-31)27(41)34-16-29(43)44)36-24(39)15-32-26(40)20-7-5-18(6-8-20)19-9-11-21(30)12-10-19;1-2/h5-12,17,22,25,37,43-44H,2-4,13-16,31H2,1H3,(H,32,40)(H,33,42)(H,34,41)(H,35,38)(H,36,39);1-2H3 |
| InChIKey | SXTJVSQHTBDBLZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 232.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.98 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|