C6H13ClN2O2 — CID 118631937
(2S,3R)-2-(chloroamino)-N-ethyl-3-hydroxybutanamide (PubChem CID 118631937) has the molecular formula C6H13ClN2O2 and a molecular weight of 180.63 g/mol. Its IUPAC name is (2S,3R)-2-(chloroamino)-N-ethyl-3-hydroxybutanamide.
| Compound Name | (2S,3R)-2-(chloroamino)-N-ethyl-3-hydroxybutanamide |
|---|---|
| PubChem CID | 118631937 |
| Molecular Formula | C6H13ClN2O2 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | (2S,3R)-2-(chloroamino)-N-ethyl-3-hydroxybutanamide |
| SMILES | CCNC(=O)[C@@H](NCl)[C@@H](C)O |
| InChI | InChI=1S/C6H13ClN2O2/c1-3-8-6(11)5(9-7)4(2)10/h4-5,9-10H,3H2,1-2H3,(H,8,11)/t4-,5+/m1/s1 |
| InChIKey | LZFRNCPERNOLAR-UHNVWZDZSA-N |
| XLogP | -0.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|