C12H30N4O2 — CID 143299850
2-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-3-methylbutanamide;azane;ethane (PubChem CID 143299850) has the molecular formula C12H30N4O2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-3-methylbutanamide;azane;ethane.
| Compound Name | 2-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-3-methylbutanamide;azane;ethane |
|---|---|
| PubChem CID | 143299850 |
| Molecular Formula | C12H30N4O2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 2-[[(2S)-2-aminopropanoyl]amino]-N-ethyl-3-methylbutanamide;azane;ethane |
| SMILES | CC.CCNC(=O)C(NC(=O)[C@H](C)N)C(C)C.N |
| InChI | InChI=1S/C10H21N3O2.C2H6.H3N/c1-5-12-10(15)8(6(2)3)13-9(14)7(4)11;1-2;/h6-8H,5,11H2,1-4H3,(H,12,15)(H,13,14);1-2H3;1H3/t7-,8?;;/m0../s1 |
| InChIKey | YRYPRNOOUPKYEH-LYJMGTGMSA-N |
| XLogP | 0.80 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |