C8H15NO3 — CID 87990992
(2S,3S)-3-formyl-4-methyl-2-(methylamino)pentanoic acid (PubChem CID 87990992) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (2S,3S)-3-formyl-4-methyl-2-(methylamino)pentanoic acid.
| Compound Name | (2S,3S)-3-formyl-4-methyl-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 87990992 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2S,3S)-3-formyl-4-methyl-2-(methylamino)pentanoic acid |
| SMILES | CN[C@H](C(=O)O)[C@@H](C=O)C(C)C |
| InChI | InChI=1S/C8H15NO3/c1-5(2)6(4-10)7(9-3)8(11)12/h4-7,9H,1-3H3,(H,11,12)/t6-,7-/m0/s1 |
| InChIKey | QPZSBNNMTIUEAD-BQBZGAKWSA-N |
| XLogP | 0.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|