C30H58 — CID 123796552
11,13-dimethyl-17-pent-3-en-2-yltricos-9-ene (PubChem CID 123796552) has the molecular formula C30H58 and a molecular weight of 418.79 g/mol. Its IUPAC name is 11,13-dimethyl-17-pent-3-en-2-yltricos-9-ene.
| Compound Name | 11,13-dimethyl-17-pent-3-en-2-yltricos-9-ene |
|---|---|
| PubChem CID | 123796552 |
| Molecular Formula | C30H58 |
| Molecular Weight | 418.79 g/mol |
| Exact Mass | 418.45 |
| IUPAC Name | 11,13-dimethyl-17-pent-3-en-2-yltricos-9-ene |
| SMILES | CC=CC(C)C(CCCCCC)CCCC(C)CC(C)C=CCCCCCCCC |
| InChI | InChI=1S/C30H58/c1-7-10-12-14-15-16-17-18-22-27(4)26-28(5)23-20-25-30(29(6)21-9-3)24-19-13-11-8-2/h9,18,21-22,27-30H,7-8,10-17,19-20,23-26H2,1-6H3 |
| InChIKey | ZFRAYEXSXLIZQC-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.79 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|