C24H48O2 — CID 123797490
14-ethyl-13-hydroxy-11,13,15,17-tetramethyloctadecan-9-one (PubChem CID 123797490) has the molecular formula C24H48O2 and a molecular weight of 368.65 g/mol. Its IUPAC name is 14-ethyl-13-hydroxy-11,13,15,17-tetramethyloctadecan-9-one.
| Compound Name | 14-ethyl-13-hydroxy-11,13,15,17-tetramethyloctadecan-9-one |
|---|---|
| PubChem CID | 123797490 |
| Molecular Formula | C24H48O2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.37 |
| IUPAC Name | 14-ethyl-13-hydroxy-11,13,15,17-tetramethyloctadecan-9-one |
| SMILES | CCCCCCCCC(=O)CC(C)CC(C)(O)C(CC)C(C)CC(C)C |
| InChI | InChI=1S/C24H48O2/c1-8-10-11-12-13-14-15-22(25)17-20(5)18-24(7,26)23(9-2)21(6)16-19(3)4/h19-21,23,26H,8-18H2,1-7H3 |
| InChIKey | XWIOBKFZVAUFJI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|