C22H18N4O — CID 123798696
N-[6-[(2-aminopyrimidin-4-yl)methyl]naphthalen-2-yl]benzamide (PubChem CID 123798696) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[6-[(2-aminopyrimidin-4-yl)methyl]naphthalen-2-yl]benzamide.
| Compound Name | N-[6-[(2-aminopyrimidin-4-yl)methyl]naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 123798696 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[6-[(2-aminopyrimidin-4-yl)methyl]naphthalen-2-yl]benzamide |
| SMILES | Nc1nccc(Cc2ccc3cc(NC(=O)c4ccccc4)ccc3c2)n1 |
| InChI | InChI=1S/C22H18N4O/c23-22-24-11-10-20(26-22)13-15-6-7-18-14-19(9-8-17(18)12-15)25-21(27)16-4-2-1-3-5-16/h1-12,14H,13H2,(H,25,27)(H2,23,24,26) |
| InChIKey | HJBXZVPSECXGOU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |