C39H72N4 — CID 123798797
6-ethyl-N,2,2,4,4,6-hexamethyl-N-[3,3,5-trimethyl-5-[5-methylidene-4-(3-methylpentan-3-yl)pyrazin-2-yl]-2-(propan-2-ylideneamino)hex-1-enyl]octan-1-amine (PubChem CID 123798797) has the molecular formula C39H72N4 and a molecular weight of 597.03 g/mol. Its IUPAC name is 6-ethyl-N,2,2,4,4,6-hexamethyl-N-[3,3,5-trimethyl-5-[5-methylidene-4-(3-methylpentan-3-yl)pyrazin-2-yl]-2-(propan-2-ylideneamino)hex-1-enyl]octan-1-amine.
| Compound Name | 6-ethyl-N,2,2,4,4,6-hexamethyl-N-[3,3,5-trimethyl-5-[5-methylidene-4-(3-methylpentan-3-yl)pyrazin-2-yl]-2-(propan-2-ylideneamino)hex-1-enyl]octan-1-amine |
|---|---|
| PubChem CID | 123798797 |
| Molecular Formula | C39H72N4 |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.58 |
| IUPAC Name | 6-ethyl-N,2,2,4,4,6-hexamethyl-N-[3,3,5-trimethyl-5-[5-methylidene-4-(3-methylpentan-3-yl)pyrazin-2-yl]-2-(propan-2-ylideneamino)hex-1-enyl]octan-1-amine |
| SMILES | C=C1C=NC(C(C)(C)CC(C)(C)C(=CN(C)CC(C)(C)CC(C)(C)CC(C)(CC)CC)N=C(C)C)=CN1C(C)(CC)CC |
| InChI | InChI=1S/C39H72N4/c1-19-38(16,20-2)27-34(8,9)26-35(10,11)29-42(18)24-33(41-30(5)6)37(14,15)28-36(12,13)32-25-43(31(7)23-40-32)39(17,21-3)22-4/h23-25H,7,19-22,26-29H2,1-6,8-18H3 |
| InChIKey | GVGXCONJWHOACX-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|