C18H34N2 — CID 123474836
1-(3-methylbutyl)-5-(7-methyloctyl)-2H-pyrazine (PubChem CID 123474836) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-(3-methylbutyl)-5-(7-methyloctyl)-2H-pyrazine.
| Compound Name | 1-(3-methylbutyl)-5-(7-methyloctyl)-2H-pyrazine |
|---|---|
| PubChem CID | 123474836 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-(3-methylbutyl)-5-(7-methyloctyl)-2H-pyrazine |
| SMILES | CC(C)CCCCCCC1=CN(CCC(C)C)CC=N1 |
| InChI | InChI=1S/C18H34N2/c1-16(2)9-7-5-6-8-10-18-15-20(14-12-19-18)13-11-17(3)4/h12,15-17H,5-11,13-14H2,1-4H3 |
| InChIKey | YDBSUEIAICEQLF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|