C21H42N2 — CID 123304887
N,8-diethyl-2-(methylideneamino)-N-(4-methylpentyl)dec-1-en-1-amine (PubChem CID 123304887) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is N,8-diethyl-2-(methylideneamino)-N-(4-methylpentyl)dec-1-en-1-amine.
| Compound Name | N,8-diethyl-2-(methylideneamino)-N-(4-methylpentyl)dec-1-en-1-amine |
|---|---|
| PubChem CID | 123304887 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | N,8-diethyl-2-(methylideneamino)-N-(4-methylpentyl)dec-1-en-1-amine |
| SMILES | C=NC(=CN(CC)CCCC(C)C)CCCCCC(CC)CC |
| InChI | InChI=1S/C21H42N2/c1-7-20(8-2)15-11-10-12-16-21(22-6)18-23(9-3)17-13-14-19(4)5/h18-20H,6-17H2,1-5H3 |
| InChIKey | JHSMTSCSRIIYFB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|