C16H31N — CID 134583642
5-ethyl-N,7-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-1-amine (PubChem CID 134583642) has the molecular formula C16H31N and a molecular weight of 237.42 g/mol. Its IUPAC name is 5-ethyl-N,7-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-1-amine.
| Compound Name | 5-ethyl-N,7-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-1-amine |
|---|---|
| PubChem CID | 134583642 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.42 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 5-ethyl-N,7-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-1-amine |
| SMILES | CCC(CCCCN(C)C(=C)C)C(=C)C(C)C |
| InChI | InChI=1S/C16H31N/c1-8-16(15(6)13(2)3)11-9-10-12-17(7)14(4)5/h13,16H,4,6,8-12H2,1-3,5,7H3 |
| InChIKey | SIEJJTVWXPDJDR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | 240 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|