C20H37N — CID 68302295
N-tert-butyl-3-(2,4-dimethylcyclohex-3-en-1-yl)-2-methyl-N-prop-1-en-2-ylbutan-1-amine (PubChem CID 68302295) has the molecular formula C20H37N and a molecular weight of 291.50 g/mol. Its IUPAC name is N-tert-butyl-3-(2,4-dimethylcyclohex-3-en-1-yl)-2-methyl-N-prop-1-en-2-ylbutan-1-amine.
| Compound Name | N-tert-butyl-3-(2,4-dimethylcyclohex-3-en-1-yl)-2-methyl-N-prop-1-en-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 68302295 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | N-tert-butyl-3-(2,4-dimethylcyclohex-3-en-1-yl)-2-methyl-N-prop-1-en-2-ylbutan-1-amine |
| SMILES | CC1C=C(CCC1C(C)C(C)CN(C(=C)C)C(C)(C)C)C |
| InChI | InChI=1S/C20H37N/c1-14(2)21(20(7,8)9)13-17(5)18(6)19-11-10-15(3)12-16(19)4/h12,16-19H,1,10-11,13H2,2-9H3 |
| InChIKey | PBXZVQYAMHXNKJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 385 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|