C28H32N7O3+ — CID 123800526
N-[3-[[2-[2-methoxy-5-methyl-4-(1-methylpiperidin-4-yl)anilino]-7H-purin-1-ium-6-yl]oxy]phenyl]prop-2-enamide (PubChem CID 123800526) has the molecular formula C28H32N7O3+ and a molecular weight of 514.61 g/mol. Its IUPAC name is N-[3-[[2-[2-methoxy-5-methyl-4-(1-methylpiperidin-4-yl)anilino]-7H-purin-1-ium-6-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[2-methoxy-5-methyl-4-(1-methylpiperidin-4-yl)anilino]-7H-purin-1-ium-6-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123800526 |
| Molecular Formula | C28H32N7O3+ |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-[3-[[2-[2-methoxy-5-methyl-4-(1-methylpiperidin-4-yl)anilino]-7H-purin-1-ium-6-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2[nH+]c(Nc3cc(C)c(C4CCN(C)CC4)cc3OC)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C28H31N7O3/c1-5-24(36)31-19-7-6-8-20(14-19)38-27-25-26(30-16-29-25)33-28(34-27)32-22-13-17(2)21(15-23(22)37-4)18-9-11-35(3)12-10-18/h5-8,13-16,18H,1,9-12H2,2-4H3,(H,31,36)(H2,29,30,32,33,34)/p+1 |
| InChIKey | NZZRBLRSYHFOJN-UHFFFAOYSA-O |
| XLogP | 4.56 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|