C16H22N4O — CID 123800623
1-(2,2-dimethylpropyl)-5-(3-isocyanopropyl)-3-methylimidazo[4,5-b]pyridin-2-one (PubChem CID 123800623) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-5-(3-isocyanopropyl)-3-methylimidazo[4,5-b]pyridin-2-one.
| Compound Name | 1-(2,2-dimethylpropyl)-5-(3-isocyanopropyl)-3-methylimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 123800623 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-5-(3-isocyanopropyl)-3-methylimidazo[4,5-b]pyridin-2-one |
| SMILES | [C-]#[N+]CCCc1ccc2c(n1)n(C)c(=O)n2CC(C)(C)C |
| InChI | InChI=1S/C16H22N4O/c1-16(2,3)11-20-13-9-8-12(7-6-10-17-4)18-14(13)19(5)15(20)21/h8-9H,6-7,10-11H2,1-3,5H3 |
| InChIKey | BHOMGYSFMQIYPQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|