C23H21Cl2N4O+ — CID 123800674
N-cyclobutyl-N-[3-[(2,6-dichlorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 123800674) has the molecular formula C23H21Cl2N4O+ and a molecular weight of 440.35 g/mol. Its IUPAC name is N-cyclobutyl-N-[3-[(2,6-dichlorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-cyclobutyl-N-[3-[(2,6-dichlorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 123800674 |
| Molecular Formula | C23H21Cl2N4O+ |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-cyclobutyl-N-[3-[(2,6-dichlorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | Clc1cccc(Cl)c1COc1cccc(N(C2CCC2)[N+]23C=CN=CC2=CN=C3)c1 |
| InChI | InChI=1S/C23H21Cl2N4O/c24-22-8-3-9-23(25)21(22)15-30-20-7-2-6-18(12-20)28(17-4-1-5-17)29-11-10-26-13-19(29)14-27-16-29/h2-3,6-14,16-17H,1,4-5,15H2/q+1 |
| InChIKey | YFFOEBOOCMWBJJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|