C26H23F3N4O4 — CID 123802448
3-[2-(difluoromethoxy)phenyl]-11-fluoro-12-[2-(oxan-4-yl)pyrimidin-5-yl]-4-oxa-1,8-diazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol (PubChem CID 123802448) has the molecular formula C26H23F3N4O4 and a molecular weight of 512.49 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-11-fluoro-12-[2-(oxan-4-yl)pyrimidin-5-yl]-4-oxa-1,8-diazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-11-fluoro-12-[2-(oxan-4-yl)pyrimidin-5-yl]-4-oxa-1,8-diazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol |
|---|---|
| PubChem CID | 123802448 |
| Molecular Formula | C26H23F3N4O4 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-11-fluoro-12-[2-(oxan-4-yl)pyrimidin-5-yl]-4-oxa-1,8-diazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-6-ol |
| SMILES | OC1COC(c2ccccc2OC(F)F)c2c1nc1cc(F)c(-c3cnc(C4CCOCC4)nc3)cn21 |
| InChI | InChI=1S/C26H23F3N4O4/c27-18-9-21-32-22-19(34)13-36-24(16-3-1-2-4-20(16)37-26(28)29)23(22)33(21)12-17(18)15-10-30-25(31-11-15)14-5-7-35-8-6-14/h1-4,9-12,14,19,24,26,34H,5-8,13H2 |
| InChIKey | FNFCSFPNBSBFBL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |