C33H33N3O4S — CID 123802464
1-[5-[8-(4-ethylidenecyclohexa-1,5-dien-1-yl)-7-methoxy-1-thiophen-3-yl-4H-chromeno[3,4-d]pyrazole-3-carbonyl]-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanone (PubChem CID 123802464) has the molecular formula C33H33N3O4S and a molecular weight of 567.71 g/mol. Its IUPAC name is 1-[5-[8-(4-ethylidenecyclohexa-1,5-dien-1-yl)-7-methoxy-1-thiophen-3-yl-4H-chromeno[3,4-d]pyrazole-3-carbonyl]-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanone.
| Compound Name | 1-[5-[8-(4-ethylidenecyclohexa-1,5-dien-1-yl)-7-methoxy-1-thiophen-3-yl-4H-chromeno[3,4-d]pyrazole-3-carbonyl]-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanone |
|---|---|
| PubChem CID | 123802464 |
| Molecular Formula | C33H33N3O4S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | 1-[5-[8-(4-ethylidenecyclohexa-1,5-dien-1-yl)-7-methoxy-1-thiophen-3-yl-4H-chromeno[3,4-d]pyrazole-3-carbonyl]-3,4,7,8-tetrahydro-2H-azocin-1-yl]ethanone |
| SMILES | CC=C1C=CC(c2cc3c(cc2OC)OCc2c(C(=O)C4=CCCN(C(C)=O)CCC4)nn(-c4ccsc4)c2-3)=CC1 |
| InChI | InChI=1S/C33H33N3O4S/c1-4-22-9-11-23(12-10-22)26-17-27-30(18-29(26)39-3)40-19-28-31(34-36(32(27)28)25-13-16-41-20-25)33(38)24-7-5-14-35(21(2)37)15-6-8-24/h4,7,9,11-13,16-18,20H,5-6,8,10,14-15,19H2,1-3H3 |
| InChIKey | LYDQLTWCOHOYAT-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |