C8H12FNO — CID 123802805
2-amino-2-(4-fluorocyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 123802805) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-amino-2-(4-fluorocyclohexa-2,4-dien-1-yl)ethanol.
| Compound Name | 2-amino-2-(4-fluorocyclohexa-2,4-dien-1-yl)ethanol |
|---|---|
| PubChem CID | 123802805 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-amino-2-(4-fluorocyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | NC(CO)C1C=CC(F)=CC1 |
| InChI | InChI=1S/C8H12FNO/c9-7-3-1-6(2-4-7)8(10)5-11/h1,3-4,6,8,11H,2,5,10H2 |
| InChIKey | UIZVUBLPMPLKBZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |