C11H18FNO — CID 142806656
(4E,6E)-2-amino-4-ethenyl-7-fluoro-3-methylocta-4,6-dien-1-ol (PubChem CID 142806656) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is (4E,6E)-2-amino-4-ethenyl-7-fluoro-3-methylocta-4,6-dien-1-ol.
| Compound Name | (4E,6E)-2-amino-4-ethenyl-7-fluoro-3-methylocta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 142806656 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (4E,6E)-2-amino-4-ethenyl-7-fluoro-3-methylocta-4,6-dien-1-ol |
| SMILES | C=C/C(=C\C=C(/C)F)C(C)C(N)CO |
| InChI | InChI=1S/C11H18FNO/c1-4-10(6-5-8(2)12)9(3)11(13)7-14/h4-6,9,11,14H,1,7,13H2,2-3H3/b8-5+,10-6+ |
| InChIKey | IWGMFEFDMDYXJE-YLDLMLGBSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|