C10H16FNO — CID 142547574
(4Z)-3-amino-4-ethenyl-5-fluoro-6-methylhepta-4,6-dien-1-ol (PubChem CID 142547574) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is (4Z)-3-amino-4-ethenyl-5-fluoro-6-methylhepta-4,6-dien-1-ol.
| Compound Name | (4Z)-3-amino-4-ethenyl-5-fluoro-6-methylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 142547574 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (4Z)-3-amino-4-ethenyl-5-fluoro-6-methylhepta-4,6-dien-1-ol |
| SMILES | C=C/C(=C(/F)C(=C)C)C(N)CCO |
| InChI | InChI=1S/C10H16FNO/c1-4-8(9(12)5-6-13)10(11)7(2)3/h4,9,13H,1-2,5-6,12H2,3H3/b10-8- |
| InChIKey | KVPBRXWVGVMPFL-NTMALXAHSA-N |
| XLogP | 1.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|