C12H23NO — CID 88811405
(4E,8E)-10-amino-4,8-dimethyldeca-4,8-dien-1-ol (PubChem CID 88811405) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (4E,8E)-10-amino-4,8-dimethyldeca-4,8-dien-1-ol.
| Compound Name | (4E,8E)-10-amino-4,8-dimethyldeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 88811405 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4E,8E)-10-amino-4,8-dimethyldeca-4,8-dien-1-ol |
| SMILES | C/C(=C\CN)CC/C=C(\C)CCCO |
| InChI | InChI=1S/C12H23NO/c1-11(7-4-10-14)5-3-6-12(2)8-9-13/h5,8,14H,3-4,6-7,9-10,13H2,1-2H3/b11-5+,12-8+ |
| InChIKey | LWRPQTGSSKCUNZ-QAZZFAKDSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|