C13H25NO — CID 56942566
(5E)-4-amino-6,10-dimethylundeca-5,9-dien-1-ol (PubChem CID 56942566) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (5E)-4-amino-6,10-dimethylundeca-5,9-dien-1-ol.
| Compound Name | (5E)-4-amino-6,10-dimethylundeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 56942566 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (5E)-4-amino-6,10-dimethylundeca-5,9-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/C(N)CCCO |
| InChI | InChI=1S/C13H25NO/c1-11(2)6-4-7-12(3)10-13(14)8-5-9-15/h6,10,13,15H,4-5,7-9,14H2,1-3H3/b12-10+ |
| InChIKey | IONXCPZMDZYBPG-ZRDIBKRKSA-N |
| XLogP | 2.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|