C14H24FNO2 — CID 143418544
(4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol (PubChem CID 143418544) has the molecular formula C14H24FNO2 and a molecular weight of 257.35 g/mol. Its IUPAC name is (4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol.
| Compound Name | (4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol |
|---|---|
| PubChem CID | 143418544 |
| Molecular Formula | C14H24FNO2 |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol |
| SMILES | C/C=C\C(=C/C=C(\C)C[C@H](N)CF)CC(O)CO |
| InChI | InChI=1S/C14H24FNO2/c1-3-4-12(8-14(18)10-17)6-5-11(2)7-13(16)9-15/h3-6,13-14,17-18H,7-10,16H2,1-2H3/b4-3-,11-5+,12-6+/t13-,14?/m0/s1 |
| InChIKey | QCXXBXYDLCPMDU-CNMHHUQNSA-N |
| XLogP | 1.87 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|