C13H23NO — CID 155738566
(4Z,5Z)-2-amino-4-prop-2-enylideneocta-5,7-dien-1-ol;ethane (PubChem CID 155738566) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (4Z,5Z)-2-amino-4-prop-2-enylideneocta-5,7-dien-1-ol;ethane.
| Compound Name | (4Z,5Z)-2-amino-4-prop-2-enylideneocta-5,7-dien-1-ol;ethane |
|---|---|
| PubChem CID | 155738566 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (4Z,5Z)-2-amino-4-prop-2-enylideneocta-5,7-dien-1-ol;ethane |
| SMILES | C=C/C=C\C(=C/C=C)CC(N)CO.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-3-5-7-10(6-4-2)8-11(12)9-13;1-2/h3-7,11,13H,1-2,8-9,12H2;1-2H3/b7-5-,10-6+; |
| InChIKey | RFWPZROGRYQWEN-RQLYHSFASA-N |
| XLogP | 2.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|