C12H20FNO — CID 145012073
(3E,5E)-2-amino-6-(2-fluoropropan-2-yl)-3-methylocta-3,5,7-trien-1-ol (PubChem CID 145012073) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is (3E,5E)-2-amino-6-(2-fluoropropan-2-yl)-3-methylocta-3,5,7-trien-1-ol.
| Compound Name | (3E,5E)-2-amino-6-(2-fluoropropan-2-yl)-3-methylocta-3,5,7-trien-1-ol |
|---|---|
| PubChem CID | 145012073 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (3E,5E)-2-amino-6-(2-fluoropropan-2-yl)-3-methylocta-3,5,7-trien-1-ol |
| SMILES | C=C/C(=C\C=C(/C)C(N)CO)C(C)(C)F |
| InChI | InChI=1S/C12H20FNO/c1-5-10(12(3,4)13)7-6-9(2)11(14)8-15/h5-7,11,15H,1,8,14H2,2-4H3/b9-6+,10-7+ |
| InChIKey | ULIOTHVXWCIWFT-KZZDLZNXSA-N |
| XLogP | 2.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|