C10H14F3NO2 — CID 144580569
(3E,5E)-2-amino-3-ethenyl-6-(trifluoromethoxy)hepta-3,5-dien-1-ol (PubChem CID 144580569) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is (3E,5E)-2-amino-3-ethenyl-6-(trifluoromethoxy)hepta-3,5-dien-1-ol.
| Compound Name | (3E,5E)-2-amino-3-ethenyl-6-(trifluoromethoxy)hepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 144580569 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3E,5E)-2-amino-3-ethenyl-6-(trifluoromethoxy)hepta-3,5-dien-1-ol |
| SMILES | C=C/C(=C\C=C(/C)OC(F)(F)F)C(N)CO |
| InChI | InChI=1S/C10H14F3NO2/c1-3-8(9(14)6-15)5-4-7(2)16-10(11,12)13/h3-5,9,15H,1,6,14H2,2H3/b7-4+,8-5+ |
| InChIKey | SLMYAVFYOHRSBH-NSLJXJERSA-N |
| XLogP | 1.86 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|