C8H11F2NO — CID 142559493
(4E)-2-amino-5,6-difluoro-3-methylidenehepta-4,6-dien-1-ol (PubChem CID 142559493) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is (4E)-2-amino-5,6-difluoro-3-methylidenehepta-4,6-dien-1-ol.
| Compound Name | (4E)-2-amino-5,6-difluoro-3-methylidenehepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 142559493 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (4E)-2-amino-5,6-difluoro-3-methylidenehepta-4,6-dien-1-ol |
| SMILES | C=C(F)/C(F)=C\C(=C)C(N)CO |
| InChI | InChI=1S/C8H11F2NO/c1-5(8(11)4-12)3-7(10)6(2)9/h3,8,12H,1-2,4,11H2/b7-3+ |
| InChIKey | HRJRQALBWAIXPM-XVNBXDOJSA-N |
| XLogP | 1.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|