C9H17NO — CID 90939141
2-amino-3-prop-1-enylhex-3-en-1-ol (PubChem CID 90939141) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-amino-3-prop-1-enylhex-3-en-1-ol.
| Compound Name | 2-amino-3-prop-1-enylhex-3-en-1-ol |
|---|---|
| PubChem CID | 90939141 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-amino-3-prop-1-enylhex-3-en-1-ol |
| SMILES | CC=CC(=CCC)C(N)CO |
| InChI | InChI=1S/C9H17NO/c1-3-5-8(6-4-2)9(10)7-11/h3,5-6,9,11H,4,7,10H2,1-2H3 |
| InChIKey | ZSGNSSYWLDHHCF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|