C11H18FNO — CID 142279463
(Z)-6-amino-4-ethenyl-3-(1-fluoroethenyl)hept-3-en-1-ol (PubChem CID 142279463) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is (Z)-6-amino-4-ethenyl-3-(1-fluoroethenyl)hept-3-en-1-ol.
| Compound Name | (Z)-6-amino-4-ethenyl-3-(1-fluoroethenyl)hept-3-en-1-ol |
|---|---|
| PubChem CID | 142279463 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (Z)-6-amino-4-ethenyl-3-(1-fluoroethenyl)hept-3-en-1-ol |
| SMILES | C=C/C(CC(C)N)=C(/CCO)C(=C)F |
| InChI | InChI=1S/C11H18FNO/c1-4-10(7-8(2)13)11(5-6-14)9(3)12/h4,8,14H,1,3,5-7,13H2,2H3/b11-10+ |
| InChIKey | QJEXYBCTHBFHBW-ZHACJKMWSA-N |
| XLogP | 2.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|