C11H21NO — CID 142547620
(3E)-2-amino-3-ethenyl-5-methylhexa-3,5-dien-1-ol;ethane (PubChem CID 142547620) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (3E)-2-amino-3-ethenyl-5-methylhexa-3,5-dien-1-ol;ethane.
| Compound Name | (3E)-2-amino-3-ethenyl-5-methylhexa-3,5-dien-1-ol;ethane |
|---|---|
| PubChem CID | 142547620 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3E)-2-amino-3-ethenyl-5-methylhexa-3,5-dien-1-ol;ethane |
| SMILES | C=C/C(=C\C(=C)C)C(N)CO.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-4-8(5-7(2)3)9(10)6-11;1-2/h4-5,9,11H,1-2,6,10H2,3H3;1-2H3/b8-5+; |
| InChIKey | INYAMSNNNFDCMX-HAAWTFQLSA-N |
| XLogP | 2.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|