C18H31NO2 — CID 11077232
(2R,3Z,7E,9E,13R)-2-amino-13-methoxy-10-methylhexadeca-3,7,9,15-tetraen-1-ol (PubChem CID 11077232) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (2R,3Z,7E,9E,13R)-2-amino-13-methoxy-10-methylhexadeca-3,7,9,15-tetraen-1-ol.
| Compound Name | (2R,3Z,7E,9E,13R)-2-amino-13-methoxy-10-methylhexadeca-3,7,9,15-tetraen-1-ol |
|---|---|
| PubChem CID | 11077232 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (2R,3Z,7E,9E,13R)-2-amino-13-methoxy-10-methylhexadeca-3,7,9,15-tetraen-1-ol |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CC/C=C\[C@@H](N)CO)OC |
| InChI | InChI=1S/C18H31NO2/c1-4-10-18(21-3)14-13-16(2)11-8-6-5-7-9-12-17(19)15-20/h4,6,8-9,11-12,17-18,20H,1,5,7,10,13-15,19H2,2-3H3/b8-6+,12-9-,16-11+/t17-,18+/m1/s1 |
| InChIKey | FNBNQCFXWYVXKU-NWPNHRSPSA-N |
| XLogP | 3.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|