C11H19NO — CID 143346469
1-amino-2,3,4,5-tetrahydro-1H-inden-2-ol;ethane (PubChem CID 143346469) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-amino-2,3,4,5-tetrahydro-1H-inden-2-ol;ethane.
| Compound Name | 1-amino-2,3,4,5-tetrahydro-1H-inden-2-ol;ethane |
|---|---|
| PubChem CID | 143346469 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-amino-2,3,4,5-tetrahydro-1H-inden-2-ol;ethane |
| SMILES | CC.NC1C2=C(CCC=C2)CC1O |
| InChI | InChI=1S/C9H13NO.C2H6/c10-9-7-4-2-1-3-6(7)5-8(9)11;1-2/h2,4,8-9,11H,1,3,5,10H2;1-2H3 |
| InChIKey | CQBKNAGRFYDTFC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |