C11H18F3NO — CID 91559581
3-amino-6-ethylidene-1,1,1-trifluoronon-7-en-2-ol (PubChem CID 91559581) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-amino-6-ethylidene-1,1,1-trifluoronon-7-en-2-ol.
| Compound Name | 3-amino-6-ethylidene-1,1,1-trifluoronon-7-en-2-ol |
|---|---|
| PubChem CID | 91559581 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-amino-6-ethylidene-1,1,1-trifluoronon-7-en-2-ol |
| SMILES | CC=CC(=CC)CCC(N)C(O)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO/c1-3-5-8(4-2)6-7-9(15)10(16)11(12,13)14/h3-5,9-10,16H,6-7,15H2,1-2H3 |
| InChIKey | QDJNHHUHCBZQKN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|