About 2-aminododec-8-en-3-ol
2-aminododec-8-en-3-ol (PubChem CID 162954272) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-aminododec-8-en-3-ol.
Molecular Properties
| Compound Name | 2-aminododec-8-en-3-ol |
| PubChem CID | 162954272 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-aminododec-8-en-3-ol |
| SMILES | CCCC=CCCCCC(O)C(C)N |
| InChI | InChI=1S/C12H25NO/c1-3-4-5-6-7-8-9-10-12(14)11(2)13/h5-6,11-12,14H,3-4,7-10,13H2,1-2H3 |
| InChIKey | ALEPIEAQGFDQEN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminododec-8-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminododec-8-en-3-ol?
The IUPAC name of 2-aminododec-8-en-3-ol (CID 162954272) is 2-aminododec-8-en-3-ol.
What is the SMILES notation for 2-aminododec-8-en-3-ol?
The canonical SMILES for 2-aminododec-8-en-3-ol is CCCC=CCCCCC(O)C(C)N.
What is the InChIKey of 2-aminododec-8-en-3-ol?
The InChIKey is ALEPIEAQGFDQEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-3-4-5-6-7-8-9-10-12(14)11(2)13/h5-6,11-12,14H,3-4,7-10,13H2,1-2H3.
What are the key properties of 2-aminododec-8-en-3-ol?
2-aminododec-8-en-3-ol has a molecular weight of 199.34 g/mol, XLogP of 2.61, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminododec-8-en-3-ol is sourced from PubChem (CID 162954272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).