C14H29NO — CID 10059639
(2S,3R)-2-aminotetradec-13-en-3-ol (PubChem CID 10059639) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is (2S,3R)-2-aminotetradec-13-en-3-ol.
| Compound Name | (2S,3R)-2-aminotetradec-13-en-3-ol |
|---|---|
| PubChem CID | 10059639 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | (2S,3R)-2-aminotetradec-13-en-3-ol |
| SMILES | C=CCCCCCCCCC[C@@H](O)[C@H](C)N |
| InChI | InChI=1S/C14H29NO/c1-3-4-5-6-7-8-9-10-11-12-14(16)13(2)15/h3,13-14,16H,1,4-12,15H2,2H3/t13-,14+/m0/s1 |
| InChIKey | KLWPMNOQFSPVII-UONOGXRCSA-N |
| XLogP | 3.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|