C10H17NO — CID 142947140
(6Z)-2-amino-5-methylidenenona-6,8-dien-1-ol (PubChem CID 142947140) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (6Z)-2-amino-5-methylidenenona-6,8-dien-1-ol.
| Compound Name | (6Z)-2-amino-5-methylidenenona-6,8-dien-1-ol |
|---|---|
| PubChem CID | 142947140 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (6Z)-2-amino-5-methylidenenona-6,8-dien-1-ol |
| SMILES | C=C/C=C\C(=C)CCC(N)CO |
| InChI | InChI=1S/C10H17NO/c1-3-4-5-9(2)6-7-10(11)8-12/h3-5,10,12H,1-2,6-8,11H2/b5-4- |
| InChIKey | UQAVKDDSKKRRJU-PLNGDYQASA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|