C11H17NO — CID 123990062
1-(ethylamino)-2,3,4,5-tetrahydro-1H-inden-2-ol (PubChem CID 123990062) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(ethylamino)-2,3,4,5-tetrahydro-1H-inden-2-ol.
| Compound Name | 1-(ethylamino)-2,3,4,5-tetrahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 123990062 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(ethylamino)-2,3,4,5-tetrahydro-1H-inden-2-ol |
| SMILES | CCNC1C2=C(CCC=C2)CC1O |
| InChI | InChI=1S/C11H17NO/c1-2-12-11-9-6-4-3-5-8(9)7-10(11)13/h4,6,10-13H,2-3,5,7H2,1H3 |
| InChIKey | SDGDFWVKGKHPPN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |