C11H17NO — CID 89088824
2-cyclohexa-1,3-dien-1-ylpiperidin-4-ol (PubChem CID 89088824) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylpiperidin-4-ol.
| Compound Name | 2-cyclohexa-1,3-dien-1-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 89088824 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylpiperidin-4-ol |
| SMILES | OC1CCNC(C2=CC=CCC2)C1 |
| InChI | InChI=1S/C11H17NO/c13-10-6-7-12-11(8-10)9-4-2-1-3-5-9/h1-2,4,10-13H,3,5-8H2 |
| InChIKey | GMWMCJXRJXJWFV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |