C12H21NO — CID 142589710
(6E)-7-(aminomethyl)-6-ethenylnona-6,8-dien-3-ol (PubChem CID 142589710) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (6E)-7-(aminomethyl)-6-ethenylnona-6,8-dien-3-ol.
| Compound Name | (6E)-7-(aminomethyl)-6-ethenylnona-6,8-dien-3-ol |
|---|---|
| PubChem CID | 142589710 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (6E)-7-(aminomethyl)-6-ethenylnona-6,8-dien-3-ol |
| SMILES | C=C/C(CN)=C(\C=C)CCC(O)CC |
| InChI | InChI=1S/C12H21NO/c1-4-10(11(5-2)9-13)7-8-12(14)6-3/h4-5,12,14H,1-2,6-9,13H2,3H3/b11-10- |
| InChIKey | AEAYYDYYFKBXFW-KHPPLWFESA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|