C11H19NO — CID 142409612
(4Z,5E)-6-(aminomethyl)-4-ethylideneocta-5,7-dien-1-ol (PubChem CID 142409612) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4Z,5E)-6-(aminomethyl)-4-ethylideneocta-5,7-dien-1-ol.
| Compound Name | (4Z,5E)-6-(aminomethyl)-4-ethylideneocta-5,7-dien-1-ol |
|---|---|
| PubChem CID | 142409612 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4Z,5E)-6-(aminomethyl)-4-ethylideneocta-5,7-dien-1-ol |
| SMILES | C=C/C(=C\C(=C/C)CCCO)CN |
| InChI | InChI=1S/C11H19NO/c1-3-10(6-5-7-13)8-11(4-2)9-12/h3-4,8,13H,2,5-7,9,12H2,1H3/b10-3-,11-8+ |
| InChIKey | WVXMRZLVNSYVBG-GSRSKSEFSA-N |
| XLogP | 1.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|