C10H19NO — CID 101231160
(6E)-8-amino-2,6-dimethylocta-1,6-dien-3-ol (PubChem CID 101231160) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (6E)-8-amino-2,6-dimethylocta-1,6-dien-3-ol.
| Compound Name | (6E)-8-amino-2,6-dimethylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 101231160 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (6E)-8-amino-2,6-dimethylocta-1,6-dien-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C/CN |
| InChI | InChI=1S/C10H19NO/c1-8(2)10(12)5-4-9(3)6-7-11/h6,10,12H,1,4-5,7,11H2,2-3H3/b9-6+ |
| InChIKey | PTTOIHWTXWCKSM-RMKNXTFCSA-N |
| XLogP | 1.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|