C10H19NO — CID 145335706
(2S,3E)-2-amino-3-ethenylhexa-3,5-dien-1-ol;ethane (PubChem CID 145335706) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,3E)-2-amino-3-ethenylhexa-3,5-dien-1-ol;ethane.
| Compound Name | (2S,3E)-2-amino-3-ethenylhexa-3,5-dien-1-ol;ethane |
|---|---|
| PubChem CID | 145335706 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S,3E)-2-amino-3-ethenylhexa-3,5-dien-1-ol;ethane |
| SMILES | C=C/C=C(\C=C)[C@H](N)CO.CC |
| InChI | InChI=1S/C8H13NO.C2H6/c1-3-5-7(4-2)8(9)6-10;1-2/h3-5,8,10H,1-2,6,9H2;1-2H3/b7-5+;/t8-;/m1./s1 |
| InChIKey | JJGHWSCLTVYZNW-ZLAVLSMZSA-N |
| XLogP | 1.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|