C9H17NO — CID 143077542
(Z,2S,4Z)-2-amino-4-ethylidenehept-5-en-1-ol (PubChem CID 143077542) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z,2S,4Z)-2-amino-4-ethylidenehept-5-en-1-ol.
| Compound Name | (Z,2S,4Z)-2-amino-4-ethylidenehept-5-en-1-ol |
|---|---|
| PubChem CID | 143077542 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z,2S,4Z)-2-amino-4-ethylidenehept-5-en-1-ol |
| SMILES | C/C=C\C(=C/C)C[C@H](N)CO |
| InChI | InChI=1S/C9H17NO/c1-3-5-8(4-2)6-9(10)7-11/h3-5,9,11H,6-7,10H2,1-2H3/b5-3-,8-4+/t9-/m0/s1 |
| InChIKey | HWBUCDPNTZLOOF-OMYSDPPZSA-N |
| XLogP | 1.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|