C18H36FNO3 — CID 143418543
(4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol;ethane;methoxymethane (PubChem CID 143418543) has the molecular formula C18H36FNO3 and a molecular weight of 333.49 g/mol. Its IUPAC name is (4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol;ethane;methoxymethane.
| Compound Name | (4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol;ethane;methoxymethane |
|---|---|
| PubChem CID | 143418543 |
| Molecular Formula | C18H36FNO3 |
| Molecular Weight | 333.49 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | (4Z,6E,9S)-9-amino-10-fluoro-7-methyl-4-[(Z)-prop-1-enyl]deca-4,6-diene-1,2-diol;ethane;methoxymethane |
| SMILES | C/C=C\C(=C/C=C(\C)C[C@H](N)CF)CC(O)CO.CC.COC |
| InChI | InChI=1S/C14H24FNO2.C2H6O.C2H6/c1-3-4-12(8-14(18)10-17)6-5-11(2)7-13(16)9-15;1-3-2;1-2/h3-6,13-14,17-18H,7-10,16H2,1-2H3;1-2H3;1-2H3/b4-3-,11-5+,12-6+;;/t13-,14?;;/m0../s1 |
| InChIKey | XKDHGHJNOAJVGD-VYXIFWBNSA-N |
| XLogP | 3.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|